C22H24ClN3O4S — CID 50824181
4-chloro-N-(6-cyclohexylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)benzamide (PubChem CID 50824181) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is 4-chloro-N-(6-cyclohexylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)benzamide.
| Compound Name | 4-chloro-N-(6-cyclohexylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)benzamide |
|---|---|
| PubChem CID | 50824181 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-chloro-N-(6-cyclohexylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)benzamide |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)C3CCCCC3)c(NC(=O)c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-25-18-12-17(24-21(27)14-8-10-15(23)11-9-14)20(13-19(18)26(2)22(25)28)31(29,30)16-6-4-3-5-7-16/h8-13,16H,3-7H2,1-2H3,(H,24,27) |
| InChIKey | OHZZQFLXGJVZDD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |