C24H27F2N3O4S — CID 50824132
N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide (PubChem CID 50824132) has the molecular formula C24H27F2N3O4S and a molecular weight of 491.56 g/mol. Its IUPAC name is N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide.
| Compound Name | N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 50824132 |
| Molecular Formula | C24H27F2N3O4S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-2,6-difluorobenzamide |
| SMILES | CCn1c(=O)n(CC)c2cc(S(=O)(=O)C3CCCCC3)c(NC(=O)c3c(F)cccc3F)cc21 |
| InChI | InChI=1S/C24H27F2N3O4S/c1-3-28-19-13-18(27-23(30)22-16(25)11-8-12-17(22)26)21(14-20(19)29(4-2)24(28)31)34(32,33)15-9-6-5-7-10-15/h8,11-15H,3-7,9-10H2,1-2H3,(H,27,30) |
| InChIKey | SGBNIUFZRKKGQV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |