C24H28FN3O4S — CID 50824365
N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-4-fluorobenzamide (PubChem CID 50824365) has the molecular formula C24H28FN3O4S and a molecular weight of 473.57 g/mol. Its IUPAC name is N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-4-fluorobenzamide.
| Compound Name | N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 50824365 |
| Molecular Formula | C24H28FN3O4S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-(6-cyclohexylsulfonyl-1,3-diethyl-2-oxobenzimidazol-5-yl)-4-fluorobenzamide |
| SMILES | CCn1c(=O)n(CC)c2cc(S(=O)(=O)C3CCCCC3)c(NC(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C24H28FN3O4S/c1-3-27-20-14-19(26-23(29)16-10-12-17(25)13-11-16)22(15-21(20)28(4-2)24(27)30)33(31,32)18-8-6-5-7-9-18/h10-15,18H,3-9H2,1-2H3,(H,26,29) |
| InChIKey | XSAOUGUSNYGNHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |