C17H18FN2O4S+ — CID 70908562
6-cyclopentylsulfonyl-N-(4-fluorophenyl)-1-hydroxypyridin-1-ium-3-carboxamide (PubChem CID 70908562) has the molecular formula C17H18FN2O4S+ and a molecular weight of 365.41 g/mol. Its IUPAC name is 6-cyclopentylsulfonyl-N-(4-fluorophenyl)-1-hydroxypyridin-1-ium-3-carboxamide.
| Compound Name | 6-cyclopentylsulfonyl-N-(4-fluorophenyl)-1-hydroxypyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 70908562 |
| Molecular Formula | C17H18FN2O4S+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-cyclopentylsulfonyl-N-(4-fluorophenyl)-1-hydroxypyridin-1-ium-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(S(=O)(=O)C2CCCC2)[n+](O)c1 |
| InChI | InChI=1S/C17H17FN2O4S/c18-13-6-8-14(9-7-13)19-17(21)12-5-10-16(20(22)11-12)25(23,24)15-3-1-2-4-15/h5-11,15H,1-4H2,(H-,19,21,22)/p+1 |
| InChIKey | BNVYXDXHONBFQN-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 87.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|