2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid

C6H6F2O4 — CID 135290190

IUPAC2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid
SMILESO=C(O)C1(C(=O)O)CC1C(F)F
InChIInChI=1S/C6H6F2O4/c7-3(8)2-1-6(2,4(9)10)5(11)12/h2-3H,1H2,(H,9,10)(H,11,12)
InChIKeyAUFZICDAJVDNDY-UHFFFAOYSA-N
MW180.11 g/mol
LogP0.43
Rot. Bonds3

About 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid

2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid (PubChem CID 135290190) has the molecular formula C6H6F2O4 and a molecular weight of 180.11 g/mol. Its IUPAC name is 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid.

Molecular Properties

Compound Name2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid
PubChem CID135290190
Molecular FormulaC6H6F2O4
Molecular Weight180.11 g/mol
Exact Mass180.02
IUPAC Name2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid
SMILESO=C(O)C1(C(=O)O)CC1C(F)F
InChIInChI=1S/C6H6F2O4/c7-3(8)2-1-6(2,4(9)10)5(11)12/h2-3H,1H2,(H,9,10)(H,11,12)
InChIKeyAUFZICDAJVDNDY-UHFFFAOYSA-N
XLogP0.43
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.11
LogP ≤ 50.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid?
The IUPAC name of 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid (CID 135290190) is 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid.
What is the SMILES notation for 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid?
The canonical SMILES for 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid is O=C(O)C1(C(=O)O)CC1C(F)F.
What is the InChIKey of 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid?
The InChIKey is AUFZICDAJVDNDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2O4/c7-3(8)2-1-6(2,4(9)10)5(11)12/h2-3H,1H2,(H,9,10)(H,11,12).
What are the key properties of 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid?
2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid has a molecular weight of 180.11 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)cyclopropane-1,1-dicarboxylic acid is sourced from PubChem (CID 135290190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).