C15H11F2NO3 — CID 135290673
2,6-difluoro-4-[4-(oxetan-3-yloxy)-2-pyridinyl]benzaldehyde (PubChem CID 135290673) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(oxetan-3-yloxy)-2-pyridinyl]benzaldehyde.
| Compound Name | 2,6-difluoro-4-[4-(oxetan-3-yloxy)-2-pyridinyl]benzaldehyde |
|---|---|
| PubChem CID | 135290673 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,6-difluoro-4-[4-(oxetan-3-yloxy)-2-pyridinyl]benzaldehyde |
| SMILES | O=Cc1c(F)cc(-c2cc(OC3COC3)ccn2)cc1F |
| InChI | InChI=1S/C15H11F2NO3/c16-13-3-9(4-14(17)12(13)6-19)15-5-10(1-2-18-15)21-11-7-20-8-11/h1-6,11H,7-8H2 |
| InChIKey | GVLXODGVQCHGFU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|