C17H22N3O+ — CID 135290716
3-(5-ethynyl-2-pyridinyl)-8-methyl-8-(oxetan-3-yl)-3-aza-8-azoniabicyclo[3.2.1]octane (PubChem CID 135290716) has the molecular formula C17H22N3O+ and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-(5-ethynyl-2-pyridinyl)-8-methyl-8-(oxetan-3-yl)-3-aza-8-azoniabicyclo[3.2.1]octane.
| Compound Name | 3-(5-ethynyl-2-pyridinyl)-8-methyl-8-(oxetan-3-yl)-3-aza-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 135290716 |
| Molecular Formula | C17H22N3O+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-(5-ethynyl-2-pyridinyl)-8-methyl-8-(oxetan-3-yl)-3-aza-8-azoniabicyclo[3.2.1]octane |
| SMILES | C#Cc1ccc(N2CC3CCC(C2)[N+]3(C)C2COC2)nc1 |
| InChI | InChI=1S/C17H22N3O/c1-3-13-4-7-17(18-8-13)19-9-14-5-6-15(10-19)20(14,2)16-11-21-12-16/h1,4,7-8,14-16H,5-6,9-12H2,2H3/q+1 |
| InChIKey | VHJREWHSJGLMFY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|