C16H21N3 — CID 135301699
3-(5-ethynyl-2-pyridinyl)-8-propan-2-yl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 135301699) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 3-(5-ethynyl-2-pyridinyl)-8-propan-2-yl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-(5-ethynyl-2-pyridinyl)-8-propan-2-yl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 135301699 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-(5-ethynyl-2-pyridinyl)-8-propan-2-yl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | C#Cc1ccc(N2CC3CCC(C2)N3C(C)C)nc1 |
| InChI | InChI=1S/C16H21N3/c1-4-13-5-8-16(17-9-13)18-10-14-6-7-15(11-18)19(14)12(2)3/h1,5,8-9,12,14-15H,6-7,10-11H2,2-3H3 |
| InChIKey | CFRQQSSGIJOHFV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|