C20H21NO4 — CID 135291043
(3S)-3-benzoyl-1-[3,5-bis(hydroxymethyl)phenyl]-3-methylpyrrolidin-2-one (PubChem CID 135291043) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3S)-3-benzoyl-1-[3,5-bis(hydroxymethyl)phenyl]-3-methylpyrrolidin-2-one.
| Compound Name | (3S)-3-benzoyl-1-[3,5-bis(hydroxymethyl)phenyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 135291043 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3S)-3-benzoyl-1-[3,5-bis(hydroxymethyl)phenyl]-3-methylpyrrolidin-2-one |
| SMILES | C[C@@]1(C(=O)c2ccccc2)CCN(c2cc(CO)cc(CO)c2)C1=O |
| InChI | InChI=1S/C20H21NO4/c1-20(18(24)16-5-3-2-4-6-16)7-8-21(19(20)25)17-10-14(12-22)9-15(11-17)13-23/h2-6,9-11,22-23H,7-8,12-13H2,1H3/t20-/m0/s1 |
| InChIKey | WQCIQLCZDVPVFH-FQEVSTJZSA-N |
| XLogP | 2.30 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|