C14H19F2N — CID 135291097
(1S,5R)-1-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-ethyl-3-azabicyclo[3.1.0]hexane (PubChem CID 135291097) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (1S,5R)-1-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-ethyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-1-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-ethyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 135291097 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (1S,5R)-1-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-ethyl-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C(/C=C\C(F)=C(/C)F)[C@]12C[C@H]1CN(CC)C2 |
| InChI | InChI=1S/C14H19F2N/c1-4-17-8-12-7-14(12,9-17)10(2)5-6-13(16)11(3)15/h5-6,12H,2,4,7-9H2,1,3H3/b6-5-,13-11-/t12-,14+/m0/s1 |
| InChIKey | VVAXKAABHAEVJD-PVQFWUROSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|