C26H32N2+2 — CID 135291635
1,4-bis[2-(3-ethenylphenyl)ethyl]-1,4-dimethylpyrazine-1,4-diium (PubChem CID 135291635) has the molecular formula C26H32N2+2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 1,4-bis[2-(3-ethenylphenyl)ethyl]-1,4-dimethylpyrazine-1,4-diium.
| Compound Name | 1,4-bis[2-(3-ethenylphenyl)ethyl]-1,4-dimethylpyrazine-1,4-diium |
|---|---|
| PubChem CID | 135291635 |
| Molecular Formula | C26H32N2+2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1,4-bis[2-(3-ethenylphenyl)ethyl]-1,4-dimethylpyrazine-1,4-diium |
| SMILES | C=Cc1cccc(CC[N+]2(C)C=C[N+](C)(CCc3cccc(C=C)c3)C=C2)c1 |
| InChI | InChI=1S/C26H32N2/c1-5-23-9-7-11-25(21-23)13-15-27(3)17-19-28(4,20-18-27)16-14-26-12-8-10-24(6-2)22-26/h5-12,17-22H,1-2,13-16H2,3-4H3/q+2 |
| InChIKey | UEDHFASQPBWSPK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|