C16H29NSi2 — CID 22600308
2-(3-ethenylphenyl)-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 22600308) has the molecular formula C16H29NSi2 and a molecular weight of 291.59 g/mol. Its IUPAC name is 2-(3-ethenylphenyl)-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | 2-(3-ethenylphenyl)-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 22600308 |
| Molecular Formula | C16H29NSi2 |
| Molecular Weight | 291.59 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-(3-ethenylphenyl)-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | C=Cc1cccc(CCN([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H29NSi2/c1-8-15-10-9-11-16(14-15)12-13-17(18(2,3)4)19(5,6)7/h8-11,14H,1,12-13H2,2-7H3 |
| InChIKey | WNMLPDUYQFIQGE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|