About 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone
1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone (PubChem CID 135291925) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone |
| PubChem CID | 135291925 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2nc3c(o2)CCC=C3C)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-10-4-3-5-14-15(10)18-16(20-14)17-13-8-6-12(7-9-13)11(2)19/h4,6-9H,3,5H2,1-2H3,(H,17,18) |
| InChIKey | DFQBWCHKZPVXMY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone?
The IUPAC name of 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone (CID 135291925) is 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone.
What is the SMILES notation for 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone?
The canonical SMILES for 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone is CC(=O)c1ccc(Nc2nc3c(o2)CCC=C3C)cc1.
What is the InChIKey of 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone?
The InChIKey is DFQBWCHKZPVXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-10-4-3-5-14-15(10)18-16(20-14)17-13-8-6-12(7-9-13)11(2)19/h4,6-9H,3,5H2,1-2H3,(H,17,18).
What are the key properties of 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone?
1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone has a molecular weight of 268.32 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(4-methyl-6,7-dihydro-1,3-benzoxazol-2-yl)amino]phenyl]ethanone is sourced from PubChem (CID 135291925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).