C15H27NO2 — CID 135292478
1-amino-1-(7-ethyl-3-hydroxy-3-methyl-1-bicyclo[3.3.1]nonanyl)propan-2-one (PubChem CID 135292478) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-amino-1-(7-ethyl-3-hydroxy-3-methyl-1-bicyclo[3.3.1]nonanyl)propan-2-one.
| Compound Name | 1-amino-1-(7-ethyl-3-hydroxy-3-methyl-1-bicyclo[3.3.1]nonanyl)propan-2-one |
|---|---|
| PubChem CID | 135292478 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-amino-1-(7-ethyl-3-hydroxy-3-methyl-1-bicyclo[3.3.1]nonanyl)propan-2-one |
| SMILES | CCC1CC2CC(C)(O)CC(C(N)C(C)=O)(C1)C2 |
| InChI | InChI=1S/C15H27NO2/c1-4-11-5-12-6-14(3,18)9-15(7-11,8-12)13(16)10(2)17/h11-13,18H,4-9,16H2,1-3H3 |
| InChIKey | WKJYGMOFNNPYQB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |