C27H23F2N5O2S — CID 135293065
4-[[(6-cyano-5-methyl-3-pyridinyl)-methylcarbamothioyl]-(1-formylcyclobutyl)amino]-2-fluoro-N-(4-fluorophenyl)benzamide (PubChem CID 135293065) has the molecular formula C27H23F2N5O2S and a molecular weight of 519.58 g/mol. Its IUPAC name is 4-[[(6-cyano-5-methyl-3-pyridinyl)-methylcarbamothioyl]-(1-formylcyclobutyl)amino]-2-fluoro-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-[[(6-cyano-5-methyl-3-pyridinyl)-methylcarbamothioyl]-(1-formylcyclobutyl)amino]-2-fluoro-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 135293065 |
| Molecular Formula | C27H23F2N5O2S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 4-[[(6-cyano-5-methyl-3-pyridinyl)-methylcarbamothioyl]-(1-formylcyclobutyl)amino]-2-fluoro-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1cc(N(C)C(=S)N(c2ccc(C(=O)Nc3ccc(F)cc3)c(F)c2)C2(C=O)CCC2)cnc1C#N |
| InChI | InChI=1S/C27H23F2N5O2S/c1-17-12-21(15-31-24(17)14-30)33(2)26(37)34(27(16-35)10-3-11-27)20-8-9-22(23(29)13-20)25(36)32-19-6-4-18(28)5-7-19/h4-9,12-13,15-16H,3,10-11H2,1-2H3,(H,32,36) |
| InChIKey | ZEXXFHNJHHLXLH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|