C27H29F4N5O3S — CID 135293080
1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-(1-formylcyclobutyl)-1-methylthiourea (PubChem CID 135293080) has the molecular formula C27H29F4N5O3S and a molecular weight of 579.62 g/mol. Its IUPAC name is 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-(1-formylcyclobutyl)-1-methylthiourea.
| Compound Name | 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-(1-formylcyclobutyl)-1-methylthiourea |
|---|---|
| PubChem CID | 135293080 |
| Molecular Formula | C27H29F4N5O3S |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 1-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]-3-(1-formylcyclobutyl)-1-methylthiourea |
| SMILES | CN(C(=S)N(c1ccc(F)c(OCCCN2CCOCC2)c1)C1(C=O)CCC1)c1cnc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F4N5O3S/c1-34(20-14-21(27(29,30)31)23(16-32)33-17-20)25(40)36(26(18-37)6-2-7-26)19-4-5-22(28)24(15-19)39-11-3-8-35-9-12-38-13-10-35/h4-5,14-15,17-18H,2-3,6-13H2,1H3 |
| InChIKey | JLYNFVWRCYRUQT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|