C23H37N9OS — CID 135294267
(3Z)-3-hydrazinyl-3-hydrazinylidene-N-[3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-6-azabicyclo[3.1.1]heptan-6-yl]-1-(5-methylthiophen-2-yl)propyl]propanamide (PubChem CID 135294267) has the molecular formula C23H37N9OS and a molecular weight of 487.68 g/mol. Its IUPAC name is (3Z)-3-hydrazinyl-3-hydrazinylidene-N-[3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-6-azabicyclo[3.1.1]heptan-6-yl]-1-(5-methylthiophen-2-yl)propyl]propanamide.
| Compound Name | (3Z)-3-hydrazinyl-3-hydrazinylidene-N-[3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-6-azabicyclo[3.1.1]heptan-6-yl]-1-(5-methylthiophen-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 135294267 |
| Molecular Formula | C23H37N9OS |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (3Z)-3-hydrazinyl-3-hydrazinylidene-N-[3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-6-azabicyclo[3.1.1]heptan-6-yl]-1-(5-methylthiophen-2-yl)propyl]propanamide |
| SMILES | Cc1ccc(C(CCN2C3CC2CC(n2c(C)nnc2C(C)C)C3)NC(=O)C/C(=N/N)NN)s1 |
| InChI | InChI=1S/C23H37N9OS/c1-13(2)23-30-29-15(4)32(23)18-10-16-9-17(11-18)31(16)8-7-19(20-6-5-14(3)34-20)26-22(33)12-21(27-24)28-25/h5-6,13,16-19H,7-12,24-25H2,1-4H3,(H,26,33)(H,27,28) |
| InChIKey | QBYPHZNOWNXMRE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|