C31H39F2N — CID 135294976
3-[3-[2-(4,4-difluorocyclohexyl)propan-2-yl]-5-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-7-methyl-3,7-dihydroazulen-1-yl]-1,4-dimethyl-2H-azete (PubChem CID 135294976) has the molecular formula C31H39F2N and a molecular weight of 463.66 g/mol. Its IUPAC name is 3-[3-[2-(4,4-difluorocyclohexyl)propan-2-yl]-5-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-7-methyl-3,7-dihydroazulen-1-yl]-1,4-dimethyl-2H-azete.
| Compound Name | 3-[3-[2-(4,4-difluorocyclohexyl)propan-2-yl]-5-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-7-methyl-3,7-dihydroazulen-1-yl]-1,4-dimethyl-2H-azete |
|---|---|
| PubChem CID | 135294976 |
| Molecular Formula | C31H39F2N |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 3-[3-[2-(4,4-difluorocyclohexyl)propan-2-yl]-5-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-7-methyl-3,7-dihydroazulen-1-yl]-1,4-dimethyl-2H-azete |
| SMILES | CC1=CC(C)=C1C1=CC(C)C=C2C(C3=C(C)N(C)C3)=CC(C(C)(C)C3CCC(F)(F)CC3)C2=C1 |
| InChI | InChI=1S/C31H39F2N/c1-18-12-22(29-19(2)14-20(29)3)15-26-24(13-18)25(27-17-34(7)21(27)4)16-28(26)30(5,6)23-8-10-31(32,33)11-9-23/h12-16,18,23,28H,8-11,17H2,1-7H3 |
| InChIKey | LECIETNTQHTGBX-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |