C24H37F2N — CID 155106139
N-[4-(6-ethyl-3,5-difluorocyclohexa-1,3-dien-1-yl)-3,3,4-trimethylpentan-2-yl]-N,6-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 155106139) has the molecular formula C24H37F2N and a molecular weight of 377.56 g/mol. Its IUPAC name is N-[4-(6-ethyl-3,5-difluorocyclohexa-1,3-dien-1-yl)-3,3,4-trimethylpentan-2-yl]-N,6-dimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | N-[4-(6-ethyl-3,5-difluorocyclohexa-1,3-dien-1-yl)-3,3,4-trimethylpentan-2-yl]-N,6-dimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 155106139 |
| Molecular Formula | C24H37F2N |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | N-[4-(6-ethyl-3,5-difluorocyclohexa-1,3-dien-1-yl)-3,3,4-trimethylpentan-2-yl]-N,6-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CCC1C(C(C)(C)C(C)(C)C(C)N(C)C2=CCCC=C2C)=CC(F)=CC1F |
| InChI | InChI=1S/C24H37F2N/c1-9-19-20(14-18(25)15-21(19)26)24(6,7)23(4,5)17(3)27(8)22-13-11-10-12-16(22)2/h12-15,17,19,21H,9-11H2,1-8H3 |
| InChIKey | WVERENHTBFYQOW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |