C19H27F3N+ — CID 123826438
1,2,4,4-tetramethyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-3-(3,3,3-trifluoroprop-1-en-2-yl)-2,3-dihydropyridin-1-ium (PubChem CID 123826438) has the molecular formula C19H27F3N+ and a molecular weight of 326.43 g/mol. Its IUPAC name is 1,2,4,4-tetramethyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-3-(3,3,3-trifluoroprop-1-en-2-yl)-2,3-dihydropyridin-1-ium.
| Compound Name | 1,2,4,4-tetramethyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-3-(3,3,3-trifluoroprop-1-en-2-yl)-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 123826438 |
| Molecular Formula | C19H27F3N+ |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1,2,4,4-tetramethyl-1-(4-methylcyclohexa-1,3-dien-1-yl)-3-(3,3,3-trifluoroprop-1-en-2-yl)-2,3-dihydropyridin-1-ium |
| SMILES | C=C(C1C(C)[N+](C)(C2=CC=C(C)CC2)C=CC1(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H27F3N/c1-13-7-9-16(10-8-13)23(6)12-11-18(4,5)17(15(23)3)14(2)19(20,21)22/h7,9,11-12,15,17H,2,8,10H2,1,3-6H3/q+1 |
| InChIKey | QDBSJNPGRWTFSN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|