C21H19F8N — CID 162574829
7-ethenyl-9,11-difluoro-2,6,6,7-tetramethyl-8,10-bis(trifluoromethyl)-7aH-benzo[a]quinolizine (PubChem CID 162574829) has the molecular formula C21H19F8N and a molecular weight of 437.37 g/mol. Its IUPAC name is 7-ethenyl-9,11-difluoro-2,6,6,7-tetramethyl-8,10-bis(trifluoromethyl)-7aH-benzo[a]quinolizine.
| Compound Name | 7-ethenyl-9,11-difluoro-2,6,6,7-tetramethyl-8,10-bis(trifluoromethyl)-7aH-benzo[a]quinolizine |
|---|---|
| PubChem CID | 162574829 |
| Molecular Formula | C21H19F8N |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 7-ethenyl-9,11-difluoro-2,6,6,7-tetramethyl-8,10-bis(trifluoromethyl)-7aH-benzo[a]quinolizine |
| SMILES | C=CC1(C)C2C(=C3C=C(C)C=CN3C1(C)C)C(F)=C(C(F)(F)F)C(F)=C2C(F)(F)F |
| InChI | InChI=1S/C21H19F8N/c1-6-19(5)13-12(11-9-10(2)7-8-30(11)18(19,3)4)16(22)15(21(27,28)29)17(23)14(13)20(24,25)26/h6-9,13H,1H2,2-5H3 |
| InChIKey | GOHMFWXMLQPXQB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|