C20H23F4N — CID 162549812
11,11-diethyl-14-fluoro-5-(trifluoromethyl)-7-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,12,14-pentaene (PubChem CID 162549812) has the molecular formula C20H23F4N and a molecular weight of 353.40 g/mol. Its IUPAC name is 11,11-diethyl-14-fluoro-5-(trifluoromethyl)-7-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,12,14-pentaene.
| Compound Name | 11,11-diethyl-14-fluoro-5-(trifluoromethyl)-7-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,12,14-pentaene |
|---|---|
| PubChem CID | 162549812 |
| Molecular Formula | C20H23F4N |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 11,11-diethyl-14-fluoro-5-(trifluoromethyl)-7-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,12,14-pentaene |
| SMILES | CCC1(CC)CCCN2C=C(C(F)(F)F)C=CC2=C2CC=C(F)C=C21 |
| InChI | InChI=1S/C20H23F4N/c1-3-19(4-2)10-5-11-25-13-14(20(22,23)24)6-9-18(25)16-8-7-15(21)12-17(16)19/h6-7,9,12-13H,3-5,8,10-11H2,1-2H3 |
| InChIKey | JEZOOTCGRJEXII-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |