C26H41F6N2+ — CID 162547093
(1Z,3E)-4-[2-(1-butyl-1-methyl-2,3,4,7-tetrahydroazepin-1-ium-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-N-methyl-N-prop-2-enylocta-1,3-dien-1-amine (PubChem CID 162547093) has the molecular formula C26H41F6N2+ and a molecular weight of 495.62 g/mol. Its IUPAC name is (1Z,3E)-4-[2-(1-butyl-1-methyl-2,3,4,7-tetrahydroazepin-1-ium-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-N-methyl-N-prop-2-enylocta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-[2-(1-butyl-1-methyl-2,3,4,7-tetrahydroazepin-1-ium-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-N-methyl-N-prop-2-enylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 162547093 |
| Molecular Formula | C26H41F6N2+ |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (1Z,3E)-4-[2-(1-butyl-1-methyl-2,3,4,7-tetrahydroazepin-1-ium-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-N-methyl-N-prop-2-enylocta-1,3-dien-1-amine |
| SMILES | C=CCN(C)/C=C\C=C(/CCCC)C(C1=CC[N+](C)(CCCC)CCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H41F6N2/c1-6-9-13-22(14-11-18-33(4)17-8-3)24(25(27,28)29,26(30,31)32)23-15-12-20-34(5,21-16-23)19-10-7-2/h8,11,14,16,18H,3,6-7,9-10,12-13,15,17,19-21H2,1-2,4-5H3/q+1/b18-11-,22-14+ |
| InChIKey | NKBZJCLEIFRWBQ-TZNBZXGGSA-N |
| XLogP | 7.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|