C22H24F3N — CID 162580074
3,16-diethyl-16-methyl-12-(trifluoromethyl)-4-azapentacyclo[8.6.1.01,3.04,9.014,17]heptadeca-5,7,9,12,14(17)-pentaene (PubChem CID 162580074) has the molecular formula C22H24F3N and a molecular weight of 359.44 g/mol. Its IUPAC name is 3,16-diethyl-16-methyl-12-(trifluoromethyl)-4-azapentacyclo[8.6.1.01,3.04,9.014,17]heptadeca-5,7,9,12,14(17)-pentaene.
| Compound Name | 3,16-diethyl-16-methyl-12-(trifluoromethyl)-4-azapentacyclo[8.6.1.01,3.04,9.014,17]heptadeca-5,7,9,12,14(17)-pentaene |
|---|---|
| PubChem CID | 162580074 |
| Molecular Formula | C22H24F3N |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3,16-diethyl-16-methyl-12-(trifluoromethyl)-4-azapentacyclo[8.6.1.01,3.04,9.014,17]heptadeca-5,7,9,12,14(17)-pentaene |
| SMILES | CCC1(C)CC2=C3C(=C4C=CC=CN4C4(CC)CC314)CC(C(F)(F)F)=C2 |
| InChI | InChI=1S/C22H24F3N/c1-4-19(3)12-14-10-15(22(23,24)25)11-16-17-8-6-7-9-26(17)20(5-2)13-21(19,20)18(14)16/h6-10H,4-5,11-13H2,1-3H3 |
| InChIKey | YIVQHZSHQIYFHE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |