C20H19F6N — CID 162593127
2,4-diethyl-6,8-bis(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene (PubChem CID 162593127) has the molecular formula C20H19F6N and a molecular weight of 387.37 g/mol. Its IUPAC name is 2,4-diethyl-6,8-bis(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene.
| Compound Name | 2,4-diethyl-6,8-bis(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene |
|---|---|
| PubChem CID | 162593127 |
| Molecular Formula | C20H19F6N |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2,4-diethyl-6,8-bis(trifluoromethyl)-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-6,8,10,12,14-pentaene |
| SMILES | CCC12CC1(CC)N1C=CC=CC1=C1C=C(C(F)(F)F)C=C(C(F)(F)F)C12 |
| InChI | InChI=1S/C20H19F6N/c1-3-17-11-18(17,4-2)27-8-6-5-7-15(27)13-9-12(19(21,22)23)10-14(16(13)17)20(24,25)26/h5-10,16H,3-4,11H2,1-2H3 |
| InChIKey | FSSHQHLMIJOAPH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |