C22H23F6N — CID 162590834
7-ethyl-7-pent-1-en-2-yl-8,10-bis(trifluoromethyl)-6,7a-dihydrobenzo[a]quinolizine (PubChem CID 162590834) has the molecular formula C22H23F6N and a molecular weight of 415.42 g/mol. Its IUPAC name is 7-ethyl-7-pent-1-en-2-yl-8,10-bis(trifluoromethyl)-6,7a-dihydrobenzo[a]quinolizine.
| Compound Name | 7-ethyl-7-pent-1-en-2-yl-8,10-bis(trifluoromethyl)-6,7a-dihydrobenzo[a]quinolizine |
|---|---|
| PubChem CID | 162590834 |
| Molecular Formula | C22H23F6N |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 7-ethyl-7-pent-1-en-2-yl-8,10-bis(trifluoromethyl)-6,7a-dihydrobenzo[a]quinolizine |
| SMILES | C=C(CCC)C1(CC)CN2C=CC=CC2=C2C=C(C(F)(F)F)C=C(C(F)(F)F)C21 |
| InChI | InChI=1S/C22H23F6N/c1-4-8-14(3)20(5-2)13-29-10-7-6-9-18(29)16-11-15(21(23,24)25)12-17(19(16)20)22(26,27)28/h6-7,9-12,19H,3-5,8,13H2,1-2H3 |
| InChIKey | PAEKKMVANVSXJG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|