C26H30F3N — CID 166812470
4-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-3-methyl-7-prop-1-en-2-yl-9-(trifluoromethyl)-6,6a,10a,10b-tetrahydro-4H-benzo[f]isoquinoline (PubChem CID 166812470) has the molecular formula C26H30F3N and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-3-methyl-7-prop-1-en-2-yl-9-(trifluoromethyl)-6,6a,10a,10b-tetrahydro-4H-benzo[f]isoquinoline.
| Compound Name | 4-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-3-methyl-7-prop-1-en-2-yl-9-(trifluoromethyl)-6,6a,10a,10b-tetrahydro-4H-benzo[f]isoquinoline |
|---|---|
| PubChem CID | 166812470 |
| Molecular Formula | C26H30F3N |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-(3,5-dimethylcyclohexa-2,4-dien-1-yl)-3-methyl-7-prop-1-en-2-yl-9-(trifluoromethyl)-6,6a,10a,10b-tetrahydro-4H-benzo[f]isoquinoline |
| SMILES | C=C(C)C1=CC(C(F)(F)F)=CC2C3C=CN(C)C(C4C=C(C)C=C(C)C4)C3=CCC12 |
| InChI | InChI=1S/C26H30F3N/c1-15(2)23-13-19(26(27,28)29)14-24-20(23)6-7-22-21(24)8-9-30(5)25(22)18-11-16(3)10-17(4)12-18/h7-11,13-14,18,20-21,24-25H,1,6,12H2,2-5H3 |
| InChIKey | GDAKTXRHJFBGLO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|