C25H36F3N — CID 156544929
4-(3,5-dimethylcyclohexyl)-7-propan-2-yl-9-(trifluoromethyl)-3,4,7,8,9,10,10a,10b-octahydrobenzo[f]isoquinoline (PubChem CID 156544929) has the molecular formula C25H36F3N and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohexyl)-7-propan-2-yl-9-(trifluoromethyl)-3,4,7,8,9,10,10a,10b-octahydrobenzo[f]isoquinoline.
| Compound Name | 4-(3,5-dimethylcyclohexyl)-7-propan-2-yl-9-(trifluoromethyl)-3,4,7,8,9,10,10a,10b-octahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 156544929 |
| Molecular Formula | C25H36F3N |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 4-(3,5-dimethylcyclohexyl)-7-propan-2-yl-9-(trifluoromethyl)-3,4,7,8,9,10,10a,10b-octahydrobenzo[f]isoquinoline |
| SMILES | CC1CC(C)CC(C2NC=CC3C2=CC=C2C(C(C)C)CC(C(F)(F)F)CC23)C1 |
| InChI | InChI=1S/C25H36F3N/c1-14(2)22-12-18(25(26,27)28)13-23-19(22)5-6-21-20(23)7-8-29-24(21)17-10-15(3)9-16(4)11-17/h5-8,14-18,20,22-24,29H,9-13H2,1-4H3 |
| InChIKey | IHJJLVGTGIVCJD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |