C22H27BrF3N — CID 154967339
7-bromo-4-(3,5-dimethylcyclohexyl)-9-(trifluoromethyl)-3,4,7,8,10a,10b-hexahydrobenzo[f]isoquinoline (PubChem CID 154967339) has the molecular formula C22H27BrF3N and a molecular weight of 442.36 g/mol. Its IUPAC name is 7-bromo-4-(3,5-dimethylcyclohexyl)-9-(trifluoromethyl)-3,4,7,8,10a,10b-hexahydrobenzo[f]isoquinoline.
| Compound Name | 7-bromo-4-(3,5-dimethylcyclohexyl)-9-(trifluoromethyl)-3,4,7,8,10a,10b-hexahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 154967339 |
| Molecular Formula | C22H27BrF3N |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 7-bromo-4-(3,5-dimethylcyclohexyl)-9-(trifluoromethyl)-3,4,7,8,10a,10b-hexahydrobenzo[f]isoquinoline |
| SMILES | CC1CC(C)CC(C2NC=CC3C2=CC=C2C(Br)CC(C(F)(F)F)=CC23)C1 |
| InChI | InChI=1S/C22H27BrF3N/c1-12-7-13(2)9-14(8-12)21-18-4-3-17-19(16(18)5-6-27-21)10-15(11-20(17)23)22(24,25)26/h3-6,10,12-14,16,19-21,27H,7-9,11H2,1-2H3 |
| InChIKey | FAQHBJDXEKUDTE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|