C23H27F2N — CID 166812437
(4aR)-4-(3,5-dimethylcyclohex-3-en-1-yl)-7,9-difluoro-4,4a-dimethyl-3,5-dihydrobenzo[f]isoquinoline (PubChem CID 166812437) has the molecular formula C23H27F2N and a molecular weight of 355.47 g/mol. Its IUPAC name is (4aR)-4-(3,5-dimethylcyclohex-3-en-1-yl)-7,9-difluoro-4,4a-dimethyl-3,5-dihydrobenzo[f]isoquinoline.
| Compound Name | (4aR)-4-(3,5-dimethylcyclohex-3-en-1-yl)-7,9-difluoro-4,4a-dimethyl-3,5-dihydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 166812437 |
| Molecular Formula | C23H27F2N |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4aR)-4-(3,5-dimethylcyclohex-3-en-1-yl)-7,9-difluoro-4,4a-dimethyl-3,5-dihydrobenzo[f]isoquinoline |
| SMILES | CC1=CC(C)CC(C2(C)NC=CC3=c4cc(F)cc(F)c4=CC[C@]32C)C1 |
| InChI | InChI=1S/C23H27F2N/c1-14-9-15(2)11-16(10-14)23(4)22(3)7-5-18-19(20(22)6-8-26-23)12-17(24)13-21(18)25/h5-6,8-9,12-14,16,26H,7,10-11H2,1-4H3/t14?,16?,22-,23?/m1/s1 |
| InChIKey | TUPTWEARFGGTKH-WKKOTSFQSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|