C20H31F2N — CID 170229587
4-tert-butyl-1-[(4E,6Z)-4-(1,1-difluoroethyl)-3-methylideneocta-1,4,6-trien-2-yl]piperidine (PubChem CID 170229587) has the molecular formula C20H31F2N and a molecular weight of 323.47 g/mol. Its IUPAC name is 4-tert-butyl-1-[(4E,6Z)-4-(1,1-difluoroethyl)-3-methylideneocta-1,4,6-trien-2-yl]piperidine.
| Compound Name | 4-tert-butyl-1-[(4E,6Z)-4-(1,1-difluoroethyl)-3-methylideneocta-1,4,6-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 170229587 |
| Molecular Formula | C20H31F2N |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 4-tert-butyl-1-[(4E,6Z)-4-(1,1-difluoroethyl)-3-methylideneocta-1,4,6-trien-2-yl]piperidine |
| SMILES | C=C(C(=C)N1CCC(C(C)(C)C)CC1)/C(=C\C=C/C)C(C)(F)F |
| InChI | InChI=1S/C20H31F2N/c1-8-9-10-18(20(7,21)22)15(2)16(3)23-13-11-17(12-14-23)19(4,5)6/h8-10,17H,2-3,11-14H2,1,4-7H3/b9-8-,18-10+ |
| InChIKey | JIKLTJMVRUDXRF-QEYLFHHWSA-N |
| XLogP | 5.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|