C29H45F2N — CID 166907449
1-[(4Z,6E)-9-tert-butyl-4-[(Z)-1,2-difluoroethenyl]-10,12-dimethyl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine (PubChem CID 166907449) has the molecular formula C29H45F2N and a molecular weight of 445.68 g/mol. Its IUPAC name is 1-[(4Z,6E)-9-tert-butyl-4-[(Z)-1,2-difluoroethenyl]-10,12-dimethyl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine.
| Compound Name | 1-[(4Z,6E)-9-tert-butyl-4-[(Z)-1,2-difluoroethenyl]-10,12-dimethyl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine |
|---|---|
| PubChem CID | 166907449 |
| Molecular Formula | C29H45F2N |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.35 |
| IUPAC Name | 1-[(4Z,6E)-9-tert-butyl-4-[(Z)-1,2-difluoroethenyl]-10,12-dimethyl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine |
| SMILES | C=C(C)C(C(=C)C)=C(C)C(C/C=C/C=C(CCCN1CCCCC1)\C(F)=C\F)C(C)(C)C |
| InChI | InChI=1S/C29H45F2N/c1-22(2)28(23(3)4)24(5)26(29(6,7)8)17-11-10-15-25(27(31)21-30)16-14-20-32-18-12-9-13-19-32/h10-11,15,21,26H,1,3,9,12-14,16-20H2,2,4-8H3/b11-10+,25-15-,27-21- |
| InChIKey | NUMHREJYDDTJAR-GMEVGDOBSA-N |
| XLogP | 9.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|