C32H47F2N — CID 130370966
(8S,10E)-3-[1-[4-(2,2-difluoroethyl)-3-ethylcyclohepta-1,3-dien-1-yl]ethenyl]-8-(2-methylpropyl)-10-[(2Z)-penta-2,4-dienylidene]-3-azaspiro[5.5]undecane (PubChem CID 130370966) has the molecular formula C32H47F2N and a molecular weight of 483.73 g/mol. Its IUPAC name is (8S,10E)-3-[1-[4-(2,2-difluoroethyl)-3-ethylcyclohepta-1,3-dien-1-yl]ethenyl]-8-(2-methylpropyl)-10-[(2Z)-penta-2,4-dienylidene]-3-azaspiro[5.5]undecane.
| Compound Name | (8S,10E)-3-[1-[4-(2,2-difluoroethyl)-3-ethylcyclohepta-1,3-dien-1-yl]ethenyl]-8-(2-methylpropyl)-10-[(2Z)-penta-2,4-dienylidene]-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 130370966 |
| Molecular Formula | C32H47F2N |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | (8S,10E)-3-[1-[4-(2,2-difluoroethyl)-3-ethylcyclohepta-1,3-dien-1-yl]ethenyl]-8-(2-methylpropyl)-10-[(2Z)-penta-2,4-dienylidene]-3-azaspiro[5.5]undecane |
| SMILES | C=C/C=C\C=C1/C[C@@H](CC(C)C)CC2(CCN(C(=C)C3=CC(CC)=C(CC(F)F)CCC3)CC2)C1 |
| InChI | InChI=1S/C32H47F2N/c1-6-8-9-11-26-19-27(18-24(3)4)23-32(22-26)14-16-35(17-15-32)25(5)29-12-10-13-30(21-31(33)34)28(7-2)20-29/h6,8-9,11,20,24,27,31H,1,5,7,10,12-19,21-23H2,2-4H3/b9-8-,26-11+/t27-/m1/s1 |
| InChIKey | KDFJLVWYNDZNKY-RVXAVCBCSA-N |
| XLogP | 9.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|