C33H47F2N — CID 129019213
10-cyclohepta-1,3,5-trien-1-yl-3-[(3Z,5Z)-4-(1,1-difluoroethyl)-6-ethyl-3-methylocta-1,3,5,7-tetraen-2-yl]-8-propyl-3-azaspiro[5.5]undecane (PubChem CID 129019213) has the molecular formula C33H47F2N and a molecular weight of 495.74 g/mol. Its IUPAC name is 10-cyclohepta-1,3,5-trien-1-yl-3-[(3Z,5Z)-4-(1,1-difluoroethyl)-6-ethyl-3-methylocta-1,3,5,7-tetraen-2-yl]-8-propyl-3-azaspiro[5.5]undecane.
| Compound Name | 10-cyclohepta-1,3,5-trien-1-yl-3-[(3Z,5Z)-4-(1,1-difluoroethyl)-6-ethyl-3-methylocta-1,3,5,7-tetraen-2-yl]-8-propyl-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 129019213 |
| Molecular Formula | C33H47F2N |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.37 |
| IUPAC Name | 10-cyclohepta-1,3,5-trien-1-yl-3-[(3Z,5Z)-4-(1,1-difluoroethyl)-6-ethyl-3-methylocta-1,3,5,7-tetraen-2-yl]-8-propyl-3-azaspiro[5.5]undecane |
| SMILES | C=C/C(=C\C(=C(/C)C(=C)N1CCC2(CC1)CC(CCC)CC(C1=CC=CC=CC1)C2)C(C)(F)F)CC |
| InChI | InChI=1S/C33H47F2N/c1-7-14-28-21-30(29-15-12-10-11-13-16-29)24-33(23-28)17-19-36(20-18-33)26(5)25(4)31(32(6,34)35)22-27(8-2)9-3/h8,10-13,15,22,28,30H,2,5,7,9,14,16-21,23-24H2,1,3-4,6H3/b27-22+,31-25- |
| InChIKey | WCRILVFNJZCLQV-PTJVJRRBSA-N |
| XLogP | 9.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|