C10H20N2 — CID 135295712
(4S)-3-N-ethyl-3-N,3-dimethylhexa-1,5-diene-3,4-diamine (PubChem CID 135295712) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (4S)-3-N-ethyl-3-N,3-dimethylhexa-1,5-diene-3,4-diamine.
| Compound Name | (4S)-3-N-ethyl-3-N,3-dimethylhexa-1,5-diene-3,4-diamine |
|---|---|
| PubChem CID | 135295712 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (4S)-3-N-ethyl-3-N,3-dimethylhexa-1,5-diene-3,4-diamine |
| SMILES | C=C[C@H](N)C(C)(C=C)N(C)CC |
| InChI | InChI=1S/C10H20N2/c1-6-9(11)10(4,7-2)12(5)8-3/h6-7,9H,1-2,8,11H2,3-5H3/t9-,10?/m0/s1 |
| InChIKey | FRZAJPSNHCMDIB-RGURZIINSA-N |
| XLogP | 1.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|