C24H25F2N5O2 — CID 135296007
(2R)-3-[[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]amino]propane-1,2-diol (PubChem CID 135296007) has the molecular formula C24H25F2N5O2 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2R)-3-[[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]amino]propane-1,2-diol.
| Compound Name | (2R)-3-[[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 135296007 |
| Molecular Formula | C24H25F2N5O2 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (2R)-3-[[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]amino]propane-1,2-diol |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1ccnc(NC[C@@H](O)CO)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H25F2N5O2/c1-23(2)15-6-8-24(23,19-7-9-27-22(29-19)28-11-13(33)12-32)21-14(15)10-18(30-31-21)20-16(25)4-3-5-17(20)26/h3-5,7,9-10,13,15,32-33H,6,8,11-12H2,1-2H3,(H,27,28,29)/t13-,15+,24+/m1/s1 |
| InChIKey | WDXQSZOHPGZGBL-NYWJGDLRSA-N |
| XLogP | 3.18 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |