C21H18F2N4 — CID 135295987
(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyrimidin-4-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 135295987) has the molecular formula C21H18F2N4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyrimidin-4-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyrimidin-4-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 135295987 |
| Molecular Formula | C21H18F2N4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyrimidin-4-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1ccncn1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C21H18F2N4/c1-20(2)13-6-8-21(20,17-7-9-24-11-25-17)19-12(13)10-16(26-27-19)18-14(22)4-3-5-15(18)23/h3-5,7,9-11,13H,6,8H2,1-2H3/t13-,21-/m0/s1 |
| InChIKey | REQJRQPAKIVYOD-ZSEKCTLFSA-N |
| XLogP | 4.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |