C22H19F2N3 — CID 140673440
(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyridin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 140673440) has the molecular formula C22H19F2N3 and a molecular weight of 363.41 g/mol. Its IUPAC name is (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyridin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyridin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 140673440 |
| Molecular Formula | C22H19F2N3 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-pyridin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@@]1(c1ccccn1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H19F2N3/c1-21(2)14-9-10-22(21,18-8-3-4-11-25-18)20-13(14)12-17(26-27-20)19-15(23)6-5-7-16(19)24/h3-8,11-12,14H,9-10H2,1-2H3/t14-,22+/m0/s1 |
| InChIKey | SAYYWLJPHGPPPM-RCDICMHDSA-N |
| XLogP | 5.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |