C22H21F2N5 — CID 135287405
4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-6-methylpyrimidin-2-amine (PubChem CID 135287405) has the molecular formula C22H21F2N5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 135287405 |
| Molecular Formula | C22H21F2N5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc([C@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)nc(N)n1 |
| InChI | InChI=1S/C22H21F2N5/c1-11-9-17(27-20(25)26-11)22-8-7-13(21(22,2)3)12-10-16(28-29-19(12)22)18-14(23)5-4-6-15(18)24/h4-6,9-10,13H,7-8H2,1-3H3,(H2,25,26,27)/t13-,22+/m0/s1 |
| InChIKey | DPPAGGKBNBKDIV-WHEQGISXSA-N |
| XLogP | 4.31 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |