C25H22F2N6 — CID 135287928
(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 135287928) has the molecular formula C25H22F2N6 and a molecular weight of 444.49 g/mol. Its IUPAC name is (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 135287928 |
| Molecular Formula | C25H22F2N6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Cc1ncn(-c2cccc([C@]34CC[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)n1 |
| InChI | InChI=1S/C25H22F2N6/c1-14-28-13-33(32-14)21-9-5-8-20(29-21)25-11-10-16(24(25,2)3)15-12-19(30-31-23(15)25)22-17(26)6-4-7-18(22)27/h4-9,12-13,16H,10-11H2,1-3H3/t16-,25+/m0/s1 |
| InChIKey | IVLYLJDLBDKFQE-IVCQMTBJSA-N |
| XLogP | 4.91 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |