C24H21F2N7O2S — CID 139432039
(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[2-(3-methylsulfonyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 139432039) has the molecular formula C24H21F2N7O2S and a molecular weight of 509.54 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[2-(3-methylsulfonyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[2-(3-methylsulfonyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 139432039 |
| Molecular Formula | C24H21F2N7O2S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[2-(3-methylsulfonyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1ccnc(-n3cnc(S(C)(=O)=O)n3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H21F2N7O2S/c1-23(2)14-7-9-24(23,18-8-10-27-21(29-18)33-12-28-22(32-33)36(3,34)35)20-13(14)11-17(30-31-20)19-15(25)5-4-6-16(19)26/h4-6,8,10-12,14H,7,9H2,1-3H3/t14-,24-/m0/s1 |
| InChIKey | YGCNWVBTDZUBON-BSEYFRJRSA-N |
| XLogP | 3.40 |
| TPSA | 116.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |