C25H21F2N7O — CID 135297879
1-[4-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyrazole-3-carboxamide (PubChem CID 135297879) has the molecular formula C25H21F2N7O and a molecular weight of 473.49 g/mol. Its IUPAC name is 1-[4-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135297879 |
| Molecular Formula | C25H21F2N7O |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 1-[4-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyrazole-3-carboxamide |
| SMILES | CC1(C)[C@H]2CCC1(c1ccnc(-n3ccc(C(N)=O)n3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H21F2N7O/c1-24(2)14-6-9-25(24,19-7-10-29-23(30-19)34-11-8-17(33-34)22(28)35)21-13(14)12-18(31-32-21)20-15(26)4-3-5-16(20)27/h3-5,7-8,10-12,14H,6,9H2,1-2H3,(H2,28,35)/t14-,25?/m0/s1 |
| InChIKey | GUONRASQKVOSMD-GQBYZMJGSA-N |
| XLogP | 3.70 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |