C27H22F2N6O — CID 135296089
5-[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyridine-2-carboxamide (PubChem CID 135296089) has the molecular formula C27H22F2N6O and a molecular weight of 484.51 g/mol. Its IUPAC name is 5-[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135296089 |
| Molecular Formula | C27H22F2N6O |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 5-[4-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidin-2-yl]pyridine-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1ccnc(-c3ccc(C(N)=O)nc3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C27H22F2N6O/c1-26(2)16-8-10-27(26,21-9-11-31-25(33-21)14-6-7-19(24(30)36)32-13-14)23-15(16)12-20(34-35-23)22-17(28)4-3-5-18(22)29/h3-7,9,11-13,16H,8,10H2,1-2H3,(H2,30,36)/t16-,27-/m0/s1 |
| InChIKey | FHWAPCLGPNBBMH-OQRWROFFSA-N |
| XLogP | 4.58 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |