C23H22F2N4O2S — CID 135287474
N-[6-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]methanesulfonamide (PubChem CID 135287474) has the molecular formula C23H22F2N4O2S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[6-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[6-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 135287474 |
| Molecular Formula | C23H22F2N4O2S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[6-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]methanesulfonamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(c1cccc(NS(C)(=O)=O)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C23H22F2N4O2S/c1-22(2)14-10-11-23(22,18-8-5-9-19(26-18)29-32(3,30)31)21-13(14)12-17(27-28-21)20-15(24)6-4-7-16(20)25/h4-9,12,14H,10-11H2,1-3H3,(H,26,29)/t14-,23+/m0/s1 |
| InChIKey | SVVNFBUKRFAWJP-LFVRLGFBSA-N |
| XLogP | 4.39 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |