C27H25F2N7OS — CID 162236379
6-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridazin-3-amine (PubChem CID 162236379) has the molecular formula C27H25F2N7OS and a molecular weight of 533.61 g/mol. Its IUPAC name is 6-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridazin-3-amine.
| Compound Name | 6-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 162236379 |
| Molecular Formula | C27H25F2N7OS |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 6-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridazin-3-amine |
| SMILES | C=S(C)(=O)Nc1ccc(-c2cncc([C@@]34CC[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)nn1 |
| InChI | InChI=1S/C27H25F2N7OS/c1-26(2)16-10-11-27(26,25-15(16)12-20(33-35-25)24-17(28)6-5-7-18(24)29)22-14-30-13-21(31-22)19-8-9-23(34-32-19)36-38(3,4)37/h5-9,12-14,16H,3,10-11H2,1-2,4H3,(H,34,36,37)/t16-,27-,38?/m0/s1 |
| InChIKey | RQVJNVXPRRMCOQ-GUMUVAMLSA-N |
| XLogP | 4.55 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|