C25H21F2N5 — CID 160835431
(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(2H-pyrrol-3-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 160835431) has the molecular formula C25H21F2N5 and a molecular weight of 429.47 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(2H-pyrrol-3-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(2H-pyrrol-3-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 160835431 |
| Molecular Formula | C25H21F2N5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(2H-pyrrol-3-yl)pyrazin-2-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(C3=CC=NC3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H21F2N5/c1-24(2)16-6-8-25(24,21-13-29-12-20(30-21)14-7-9-28-11-14)23-15(16)10-19(31-32-23)22-17(26)4-3-5-18(22)27/h3-5,7,9-10,12-13,16H,6,8,11H2,1-2H3/t16-,25-/m0/s1 |
| InChIKey | UNNSZGSEOSGEHW-LMKMVOKYSA-N |
| XLogP | 4.88 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |