C28H26F2N6O — CID 139432680
2-[[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-2-pyridinyl]amino]ethanol (PubChem CID 139432680) has the molecular formula C28H26F2N6O and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-2-pyridinyl]amino]ethanol.
| Compound Name | 2-[[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-2-pyridinyl]amino]ethanol |
|---|---|
| PubChem CID | 139432680 |
| Molecular Formula | C28H26F2N6O |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-2-pyridinyl]amino]ethanol |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(-c3ccc(NCCO)nc3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C28H26F2N6O/c1-27(2)18-8-9-28(27,26-17(18)12-21(35-36-26)25-19(29)4-3-5-20(25)30)23-15-31-14-22(34-23)16-6-7-24(33-13-16)32-10-11-37/h3-7,12-15,18,37H,8-11H2,1-2H3,(H,32,33)/t18-,28-/m0/s1 |
| InChIKey | PGDUSRADYGGIIA-JMQGSBJISA-N |
| XLogP | 4.88 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |