C25H25F2N5O2 — CID 135287905
6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methoxyethyl)pyrazine-2-carboxamide (PubChem CID 135287905) has the molecular formula C25H25F2N5O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methoxyethyl)pyrazine-2-carboxamide.
| Compound Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methoxyethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135287905 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methoxyethyl)pyrazine-2-carboxamide |
| SMILES | COCCNC(=O)c1cncc([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C25H25F2N5O2/c1-24(2)15-7-8-25(24,20-13-28-12-19(30-20)23(33)29-9-10-34-3)22-14(15)11-18(31-32-22)21-16(26)5-4-6-17(21)27/h4-6,11-13,15H,7-10H2,1-3H3,(H,29,33)/t15-,25-/m0/s1 |
| InChIKey | YKSFYQNVLFHTGO-MQNRADLISA-N |
| XLogP | 3.79 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|