C26H25F2N5O3 — CID 135288624
6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-[(3-hydroxyoxetan-3-yl)methyl]pyrazine-2-carboxamide (PubChem CID 135288624) has the molecular formula C26H25F2N5O3 and a molecular weight of 493.51 g/mol. Its IUPAC name is 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-[(3-hydroxyoxetan-3-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-[(3-hydroxyoxetan-3-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135288624 |
| Molecular Formula | C26H25F2N5O3 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-[(3-hydroxyoxetan-3-yl)methyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(C(=O)NCC3(O)COC3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H25F2N5O3/c1-24(2)15-6-7-26(24,20-10-29-9-19(31-20)23(34)30-11-25(35)12-36-13-25)22-14(15)8-18(32-33-22)21-16(27)4-3-5-17(21)28/h3-5,8-10,15,35H,6-7,11-13H2,1-2H3,(H,30,34)/t15-,26-/m0/s1 |
| InChIKey | CJOFKBBXYSAATP-HAWMADMCSA-N |
| XLogP | 2.91 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |