C25H26FN5O2 — CID 135287904
6-[(1S,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxypropyl)pyrazine-2-carboxamide (PubChem CID 135287904) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 6-[(1S,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxypropyl)pyrazine-2-carboxamide.
| Compound Name | 6-[(1S,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxypropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135287904 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 6-[(1S,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxypropyl)pyrazine-2-carboxamide |
| SMILES | CC(O)CNC(=O)c1cncc([C@@]23CC[C@@H](c4cc(-c5ccccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C25H26FN5O2/c1-14(32)11-28-23(33)20-12-27-13-21(29-20)25-9-8-17(24(25,2)3)16-10-19(30-31-22(16)25)15-6-4-5-7-18(15)26/h4-7,10,12-14,17,32H,8-9,11H2,1-3H3,(H,28,33)/t14?,17-,25-/m0/s1 |
| InChIKey | VPCLBSYFVKKVLU-GNRATOKXSA-N |
| XLogP | 3.39 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |